C23H29IN2O4 — CID 5168894
[2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate (PubChem CID 5168894) has the molecular formula C23H29IN2O4 and a molecular weight of 524.40 g/mol. Its IUPAC name is [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate.
| Compound Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 5168894 |
| Molecular Formula | C23H29IN2O4 |
| Molecular Weight | 524.40 g/mol |
| Exact Mass | 524.12 |
| IUPAC Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 2-[(2-iodobenzoyl)amino]acetate |
| SMILES | CC(NC(=O)COC(=O)CNC(=O)c1ccccc1I)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H29IN2O4/c1-14(23-9-15-6-16(10-23)8-17(7-15)11-23)26-20(27)13-30-21(28)12-25-22(29)18-4-2-3-5-19(18)24/h2-5,14-17H,6-13H2,1H3,(H,25,29)(H,26,27) |
| InChIKey | UJZJRAAGXRKNGH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|