C25H32N2O4 — CID 7991478
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate (PubChem CID 7991478) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
|---|---|
| PubChem CID | 7991478 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-[[(E)-3-phenylprop-2-enoyl]amino]acetate |
| SMILES | C[C@H](NC(=O)COC(=O)CNC(=O)/C=C/c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32N2O4/c1-17(25-12-19-9-20(13-25)11-21(10-19)14-25)27-23(29)16-31-24(30)15-26-22(28)8-7-18-5-3-2-4-6-18/h2-8,17,19-21H,9-16H2,1H3,(H,26,28)(H,27,29)/b8-7+/t17-,19?,20?,21?,25?/m0/s1 |
| InChIKey | FHZACADYRIYRQS-MGMMHNBZSA-N |
| XLogP | 3.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|