C27H31NO3 — CID 7229133
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7229133) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7229133 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1ccccc1-c1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H31NO3/c1-18(27-14-19-11-20(15-27)13-21(12-19)16-27)28-25(29)17-31-26(30)24-10-6-5-9-23(24)22-7-3-2-4-8-22/h2-10,18-21H,11-17H2,1H3,(H,28,29)/t18-,19?,20?,21?,27?/m0/s1 |
| InChIKey | VAVDXRWZICJXNA-MBBDBFLNSA-N |
| XLogP | 5.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |