C27H30N2O5S — CID 3662555
[2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate (PubChem CID 3662555) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate.
| Compound Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate |
|---|---|
| PubChem CID | 3662555 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [2-[1-(1-adamantyl)ethylamino]-2-oxoethyl] 5-nitro-2-phenylsulfanylbenzoate |
| SMILES | CC(NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1Sc1ccccc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H30N2O5S/c1-17(27-13-18-9-19(14-27)11-20(10-18)15-27)28-25(30)16-34-26(31)23-12-21(29(32)33)7-8-24(23)35-22-5-3-2-4-6-22/h2-8,12,17-20H,9-11,13-16H2,1H3,(H,28,30) |
| InChIKey | UTQXNBDPIDAIPX-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|