C21H26N2O5 — CID 7471523
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-nitrobenzoate (PubChem CID 7471523) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 7471523 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-nitrobenzoate |
| SMILES | C[C@H](NC(=O)COC(=O)c1cccc([N+](=O)[O-])c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H26N2O5/c1-13(21-9-14-5-15(10-21)7-16(6-14)11-21)22-19(24)12-28-20(25)17-3-2-4-18(8-17)23(26)27/h2-4,8,13-16H,5-7,9-12H2,1H3,(H,22,24)/t13-,14?,15?,16?,21?/m0/s1 |
| InChIKey | YEHFFONUVNHVMT-JHMRYYBSSA-N |
| XLogP | 3.47 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|