C20H26N2O4 — CID 7502158
N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-nitrophenoxy)acetamide (PubChem CID 7502158) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-nitrophenoxy)acetamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-nitrophenoxy)acetamide |
|---|---|
| PubChem CID | 7502158 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-nitrophenoxy)acetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc([N+](=O)[O-])cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26N2O4/c1-13(20-9-14-6-15(10-20)8-16(7-14)11-20)21-19(23)12-26-18-4-2-17(3-5-18)22(24)25/h2-5,13-16H,6-12H2,1H3,(H,21,23)/t13-,14?,15?,16?,20?/m1/s1 |
| InChIKey | CDMURHYFJWKXTO-XXWNAHEMSA-N |
| XLogP | 3.69 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|