C23H31NO3 — CID 7695372
N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-propanoylphenoxy)acetamide (PubChem CID 7695372) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-propanoylphenoxy)acetamide.
| Compound Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-propanoylphenoxy)acetamide |
|---|---|
| PubChem CID | 7695372 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-[(1S)-1-(1-adamantyl)ethyl]-2-(4-propanoylphenoxy)acetamide |
| SMILES | CCC(=O)c1ccc(OCC(=O)N[C@@H](C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-3-21(25)19-4-6-20(7-5-19)27-14-22(26)24-15(2)23-11-16-8-17(12-23)10-18(9-16)13-23/h4-7,15-18H,3,8-14H2,1-2H3,(H,24,26)/t15-,16?,17?,18?,23?/m0/s1 |
| InChIKey | NJRIHYUTWLOYGJ-SCUMNGBJSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |