C22H30N2O2S — CID 4080855
N-[1-(1-adamantyl)ethylcarbamothioyl]-2-(4-methylphenoxy)acetamide (PubChem CID 4080855) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethylcarbamothioyl]-2-(4-methylphenoxy)acetamide.
| Compound Name | N-[1-(1-adamantyl)ethylcarbamothioyl]-2-(4-methylphenoxy)acetamide |
|---|---|
| PubChem CID | 4080855 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | N-[1-(1-adamantyl)ethylcarbamothioyl]-2-(4-methylphenoxy)acetamide |
| SMILES | Cc1ccc(OCC(=O)NC(=S)NC(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C22H30N2O2S/c1-14-3-5-19(6-4-14)26-13-20(25)24-21(27)23-15(2)22-10-16-7-17(11-22)9-18(8-16)12-22/h3-6,15-18H,7-13H2,1-2H3,(H2,23,24,25,27) |
| InChIKey | AFKXAMOOLPWWQN-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|