C20H26ClNO2 — CID 7929636
N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-chlorophenoxy)acetamide (PubChem CID 7929636) has the molecular formula C20H26ClNO2 and a molecular weight of 347.89 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-chlorophenoxy)acetamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-chlorophenoxy)acetamide |
|---|---|
| PubChem CID | 7929636 |
| Molecular Formula | C20H26ClNO2 |
| Molecular Weight | 347.89 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2-(4-chlorophenoxy)acetamide |
| SMILES | C[C@@H](NC(=O)COc1ccc(Cl)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26ClNO2/c1-13(20-9-14-6-15(10-20)8-16(7-14)11-20)22-19(23)12-24-18-4-2-17(21)3-5-18/h2-5,13-16H,6-12H2,1H3,(H,22,23)/t13-,14?,15?,16?,20?/m1/s1 |
| InChIKey | ITCYXXYOSYZJTM-XXWNAHEMSA-N |
| XLogP | 4.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.89 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |