C23H31N3O5 — CID 7684676
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 7684676) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7684676 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N(C)C)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31N3O5/c1-14(23-10-15-6-16(11-23)8-17(7-15)12-23)24-21(27)13-31-22(28)19-9-18(26(29)30)4-5-20(19)25(2)3/h4-5,9,14-17H,6-8,10-13H2,1-3H3,(H,24,27)/t14-,15?,16?,17?,23?/m1/s1 |
| InChIKey | HDNPVGJFDDJFMF-KWJFTMPMSA-N |
| XLogP | 3.54 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|