C20H21N3O7 — CID 7684953
[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate (PubChem CID 7684953) has the molecular formula C20H21N3O7 and a molecular weight of 415.40 g/mol. Its IUPAC name is [2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate.
| Compound Name | [2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
|---|---|
| PubChem CID | 7684953 |
| Molecular Formula | C20H21N3O7 |
| Molecular Weight | 415.40 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | [2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-(dimethylamino)-5-nitrobenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1cc([N+](=O)[O-])ccc1N(C)C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H21N3O7/c1-12(13-4-7-17-18(8-13)30-11-29-17)21-19(24)10-28-20(25)15-9-14(23(26)27)5-6-16(15)22(2)3/h4-9,12H,10-11H2,1-3H3,(H,21,24)/t12-/m1/s1 |
| InChIKey | OUODABUWSVAVFL-GFCCVEGCSA-N |
| XLogP | 2.42 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|