C24H21NO5 — CID 7554668
[2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate (PubChem CID 7554668) has the molecular formula C24H21NO5 and a molecular weight of 403.43 g/mol. Its IUPAC name is [2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate.
| Compound Name | [2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate |
|---|---|
| PubChem CID | 7554668 |
| Molecular Formula | C24H21NO5 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | [2-[[(1R)-1-(1,3-benzodioxol-5-yl)ethyl]amino]-2-oxoethyl] 2-phenylbenzoate |
| SMILES | C[C@@H](NC(=O)COC(=O)c1ccccc1-c1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H21NO5/c1-16(18-11-12-21-22(13-18)30-15-29-21)25-23(26)14-28-24(27)20-10-6-5-9-19(20)17-7-3-2-4-8-17/h2-13,16H,14-15H2,1H3,(H,25,26)/t16-/m1/s1 |
| InChIKey | ZNGOAILHDSZLNN-MRXNPFEDSA-N |
| XLogP | 4.12 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |