C28H33NO3 — CID 7703887
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate (PubChem CID 7703887) has the molecular formula C28H33NO3 and a molecular weight of 431.58 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
|---|---|
| PubChem CID | 7703887 |
| Molecular Formula | C28H33NO3 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.25 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(4-phenylphenyl)acetate |
| SMILES | C[C@@H](NC(=O)COC(=O)Cc1ccc(-c2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H33NO3/c1-19(28-15-21-11-22(16-28)13-23(12-21)17-28)29-26(30)18-32-27(31)14-20-7-9-25(10-8-20)24-5-3-2-4-6-24/h2-10,19,21-23H,11-18H2,1H3,(H,29,30)/t19-,21?,22?,23?,28?/m1/s1 |
| InChIKey | WLQLTCPUEFBLOR-FRYXCQQQSA-N |
| XLogP | 5.16 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |