C25H32N2O3 — CID 7169318
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate (PubChem CID 7169318) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 7169318 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 3-(1H-indol-3-yl)propanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCc1c[nH]c2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H32N2O3/c1-16(25-11-17-8-18(12-25)10-19(9-17)13-25)27-23(28)15-30-24(29)7-6-20-14-26-22-5-3-2-4-21(20)22/h2-5,14,16-19,26H,6-13,15H2,1H3,(H,27,28)/t16-,17?,18?,19?,25?/m0/s1 |
| InChIKey | LOSPPOUWIJYSAN-DUXBZUBYSA-N |
| XLogP | 4.36 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |