C22H27Cl2NO3 — CID 7724671
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate (PubChem CID 7724671) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 7724671 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 2-(3,4-dichlorophenyl)acetate |
| SMILES | C[C@H](NC(=O)COC(=O)Cc1ccc(Cl)c(Cl)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H27Cl2NO3/c1-13(22-9-15-4-16(10-22)6-17(5-15)11-22)25-20(26)12-28-21(27)8-14-2-3-18(23)19(24)7-14/h2-3,7,13,15-17H,4-6,8-12H2,1H3,(H,25,26)/t13-,15?,16?,17?,22?/m0/s1 |
| InChIKey | BXTAYWSJJYDGBA-NPFQLIISSA-N |
| XLogP | 4.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |