C18H27NO3 — CID 7863390
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] cyclopropanecarboxylate (PubChem CID 7863390) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] cyclopropanecarboxylate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 7863390 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] cyclopropanecarboxylate |
| SMILES | C[C@H](NC(=O)COC(=O)C1CC1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H27NO3/c1-11(19-16(20)10-22-17(21)15-2-3-15)18-7-12-4-13(8-18)6-14(5-12)9-18/h11-15H,2-10H2,1H3,(H,19,20)/t11-,12?,13?,14?,18?/m0/s1 |
| InChIKey | BFAPTFJOKFCYBY-IWERZKIRSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |