C21H35N3O4 — CID 8860287
[2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 6-(carbamoylamino)hexanoate (PubChem CID 8860287) has the molecular formula C21H35N3O4 and a molecular weight of 393.53 g/mol. Its IUPAC name is [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 6-(carbamoylamino)hexanoate.
| Compound Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 6-(carbamoylamino)hexanoate |
|---|---|
| PubChem CID | 8860287 |
| Molecular Formula | C21H35N3O4 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.26 |
| IUPAC Name | [2-[[(1S)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] 6-(carbamoylamino)hexanoate |
| SMILES | C[C@H](NC(=O)COC(=O)CCCCCNC(N)=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H35N3O4/c1-14(21-10-15-7-16(11-21)9-17(8-15)12-21)24-18(25)13-28-19(26)5-3-2-4-6-23-20(22)27/h14-17H,2-13H2,1H3,(H,24,25)(H3,22,23,27)/t14-,15?,16?,17?,21?/m0/s1 |
| InChIKey | FKUHYNKYTYQHBQ-HILYYZTDSA-N |
| XLogP | 2.48 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|