C25H36ClNO3 — CID 7843970
[2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7843970) has the molecular formula C25H36ClNO3 and a molecular weight of 434.02 g/mol. Its IUPAC name is [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7843970 |
| Molecular Formula | C25H36ClNO3 |
| Molecular Weight | 434.02 g/mol |
| Exact Mass | 433.24 |
| IUPAC Name | [2-[[(1R)-1-(1-adamantyl)ethyl]amino]-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | C[C@@H](NC(=O)COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H36ClNO3/c1-15(23-6-16-2-17(7-23)4-18(3-16)8-23)27-21(28)13-30-22(29)24-9-19-5-20(10-24)12-25(26,11-19)14-24/h15-20H,2-14H2,1H3,(H,27,28)/t15-,16?,17?,18?,19-,20+,23?,24?,25?/m1/s1 |
| InChIKey | FKFHMUBPIZNVLP-OXTMIURXSA-N |
| XLogP | 4.83 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.02 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|