C18H26ClNO5S — CID 23310476
[2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate (PubChem CID 23310476) has the molecular formula C18H26ClNO5S and a molecular weight of 403.93 g/mol. Its IUPAC name is [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 23310476 |
| Molecular Formula | C18H26ClNO5S |
| Molecular Weight | 403.93 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | [2-[[(3S)-3-methyl-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl] (5S,7S)-3-chloroadamantane-1-carboxylate |
| SMILES | C[C@]1(NC(=O)COC(=O)C23C[C@@H]4C[C@H](CC(Cl)(C4)C2)C3)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H26ClNO5S/c1-16(2-3-26(23,24)11-16)20-14(21)9-25-15(22)17-5-12-4-13(6-17)8-18(19,7-12)10-17/h12-13H,2-11H2,1H3,(H,20,21)/t12-,13-,16-,17?,18?/m0/s1 |
| InChIKey | HCIAOXQCZWOGLX-UVKINOHLSA-N |
| XLogP | 1.80 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.93 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|