C18H27ClN2O4 — CID 7447991
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate (PubChem CID 7447991) has the molecular formula C18H27ClN2O4 and a molecular weight of 370.88 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
|---|---|
| PubChem CID | 7447991 |
| Molecular Formula | C18H27ClN2O4 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] (5S,7R)-3-chloroadamantane-1-carboxylate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)C12C[C@@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C18H27ClN2O4/c1-11(2)8-20-16(24)21-14(22)9-25-15(23)17-4-12-3-13(5-17)7-18(19,6-12)10-17/h11-13H,3-10H2,1-2H3,(H2,20,21,22,24)/t12-,13+,17?,18? |
| InChIKey | XWSRYUVEEOXUGH-NLKGSNSHSA-N |
| XLogP | 2.59 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|