C15H22N2O4 — CID 4310551
[2-(methylcarbamoylamino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 4310551) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4310551 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | CNC(=O)NC(=O)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H22N2O4/c1-16-14(20)17-12(18)8-21-13(19)15-5-9-2-10(6-15)4-11(3-9)7-15/h9-11H,2-8H2,1H3,(H2,16,17,18,20) |
| InChIKey | WPTYSTCHYMNOGR-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |