C21H33NO3 — CID 23761708
[2-(cyclooctylamino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 23761708) has the molecular formula C21H33NO3 and a molecular weight of 347.50 g/mol. Its IUPAC name is [2-(cyclooctylamino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(cyclooctylamino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 23761708 |
| Molecular Formula | C21H33NO3 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.25 |
| IUPAC Name | [2-(cyclooctylamino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)NC1CCCCCCC1 |
| InChI | InChI=1S/C21H33NO3/c23-19(22-18-6-4-2-1-3-5-7-18)14-25-20(24)21-11-15-8-16(12-21)10-17(9-15)13-21/h15-18H,1-14H2,(H,22,23) |
| InChIKey | KFFKSWHTRHEGKL-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |