C14H18F3NO5S — CID 58030646
[2-oxo-2-(trifluoromethylsulfonylamino)ethyl] adamantane-1-carboxylate (PubChem CID 58030646) has the molecular formula C14H18F3NO5S and a molecular weight of 369.36 g/mol. Its IUPAC name is [2-oxo-2-(trifluoromethylsulfonylamino)ethyl] adamantane-1-carboxylate.
| Compound Name | [2-oxo-2-(trifluoromethylsulfonylamino)ethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 58030646 |
| Molecular Formula | C14H18F3NO5S |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | [2-oxo-2-(trifluoromethylsulfonylamino)ethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C14H18F3NO5S/c15-14(16,17)24(21,22)18-11(19)7-23-12(20)13-4-8-1-9(5-13)3-10(2-8)6-13/h8-10H,1-7H2,(H,18,19) |
| InChIKey | WVJACJYJTSZTHO-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |