C23H33NO3 — CID 7514400
[2-(2-adamantylamino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 7514400) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is [2-(2-adamantylamino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(2-adamantylamino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7514400 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | [2-(2-adamantylamino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12CC3CC(CC(C3)C1)C2)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H33NO3/c25-20(24-21-18-5-13-1-14(7-18)8-19(21)6-13)12-27-22(26)23-9-15-2-16(10-23)4-17(3-15)11-23/h13-19,21H,1-12H2,(H,24,25) |
| InChIKey | MHAZUIYPLFPCBQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |