C14H20N2O4 — CID 4534845
[2-(carbamoylamino)-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 4534845) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 4534845 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | NC(=O)NC(=O)COC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C14H20N2O4/c15-13(19)16-11(17)7-20-12(18)14-4-8-1-9(5-14)3-10(2-8)6-14/h8-10H,1-7H2,(H3,15,16,17,19) |
| InChIKey | JXLFMMUJUQVHFY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |