C23H33NO4 — CID 18532833
[2-(1-adamantylamino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate (PubChem CID 18532833) has the molecular formula C23H33NO4 and a molecular weight of 387.52 g/mol. Its IUPAC name is [2-(1-adamantylamino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate.
| Compound Name | [2-(1-adamantylamino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 18532833 |
| Molecular Formula | C23H33NO4 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.24 |
| IUPAC Name | [2-(1-adamantylamino)-2-oxoethyl] (5R,7R)-3-hydroxyadamantane-1-carboxylate |
| SMILES | O=C(COC(=O)C12C[C@H]3C[C@@H](CC(O)(C3)C1)C2)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H33NO4/c25-19(24-22-7-14-1-15(8-22)3-16(2-14)9-22)12-28-20(26)21-5-17-4-18(6-21)11-23(27,10-17)13-21/h14-18,27H,1-13H2,(H,24,25)/t14?,15?,16?,17-,18-,21?,22?,23?/m1/s1 |
| InChIKey | XCDQNQOMMMNKBJ-KASCEWHMSA-N |
| XLogP | 2.95 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |