C14H21NO4 — CID 18283851
(3-amino-3-oxopropyl) 3-hydroxyadamantane-1-carboxylate (PubChem CID 18283851) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is (3-amino-3-oxopropyl) 3-hydroxyadamantane-1-carboxylate.
| Compound Name | (3-amino-3-oxopropyl) 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 18283851 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | (3-amino-3-oxopropyl) 3-hydroxyadamantane-1-carboxylate |
| SMILES | NC(=O)CCOC(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C14H21NO4/c15-11(16)1-2-19-12(17)13-4-9-3-10(5-13)7-14(18,6-9)8-13/h9-10,18H,1-8H2,(H2,15,16) |
| InChIKey | ITMPGXOURQPKIQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |