C20H34Cl2N2O4-2 — CID 21205610
bis[2-(dimethylamino)ethyl] adamantane-1,3-dicarboxylate dichloride (PubChem CID 21205610) has the molecular formula C20H34Cl2N2O4-2 and a molecular weight of 437.41 g/mol. Its IUPAC name is bis[2-(dimethylamino)ethyl] adamantane-1,3-dicarboxylate dichloride.
| Compound Name | bis[2-(dimethylamino)ethyl] adamantane-1,3-dicarboxylate dichloride |
|---|---|
| PubChem CID | 21205610 |
| Molecular Formula | C20H34Cl2N2O4-2 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | bis[2-(dimethylamino)ethyl] adamantane-1,3-dicarboxylate dichloride |
| SMILES | CN(C)CCOC(=O)C12CC3CC(C1)CC(C(=O)OCCN(C)C)(C3)C2.[Cl-].[Cl-] |
| InChI | InChI=1S/C20H34N2O4.2ClH/c1-21(2)5-7-25-17(23)19-10-15-9-16(11-19)13-20(12-15,14-19)18(24)26-8-6-22(3)4;;/h15-16H,5-14H2,1-4H3;2*1H/p-2 |
| InChIKey | KKLJDPQLFPLJBX-UHFFFAOYSA-L |
| XLogP | -4.21 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |