C12H19NO2 — CID 23309146
methyl (5R,7R)-3-aminoadamantane-1-carboxylate (PubChem CID 23309146) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is methyl (5R,7R)-3-aminoadamantane-1-carboxylate.
| Compound Name | methyl (5R,7R)-3-aminoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 23309146 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | methyl (5R,7R)-3-aminoadamantane-1-carboxylate |
| SMILES | COC(=O)C12C[C@H]3C[C@@H](CC(N)(C3)C1)C2 |
| InChI | InChI=1S/C12H19NO2/c1-15-10(14)11-3-8-2-9(4-11)6-12(13,5-8)7-11/h8-9H,2-7,13H2,1H3/t8-,9-,11?,12?/m1/s1 |
| InChIKey | YCDFPJJVFUVJJF-WWAQEKKBSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |