C26H39NO3 — CID 58493851
methyl 3-[3-[ethyl(methyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate (PubChem CID 58493851) has the molecular formula C26H39NO3 and a molecular weight of 413.60 g/mol. Its IUPAC name is methyl 3-[3-[ethyl(methyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate.
| Compound Name | methyl 3-[3-[ethyl(methyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 58493851 |
| Molecular Formula | C26H39NO3 |
| Molecular Weight | 413.60 g/mol |
| Exact Mass | 413.29 |
| IUPAC Name | methyl 3-[3-[ethyl(methyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate |
| SMILES | CCN(C)C(=O)C12CC3CC(C1)CC(C14CC5CC(CC(C(=O)OC)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C26H39NO3/c1-4-27(2)21(28)23-7-17-5-18(8-23)12-25(11-17,15-23)26-13-19-6-20(14-26)10-24(9-19,16-26)22(29)30-3/h17-20H,4-16H2,1-3H3 |
| InChIKey | QCRYHENCNRCKFG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.60 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |