C36H43NO3 — CID 58493862
methyl 3-[3-[methyl-(4-phenylphenyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate (PubChem CID 58493862) has the molecular formula C36H43NO3 and a molecular weight of 537.74 g/mol. Its IUPAC name is methyl 3-[3-[methyl-(4-phenylphenyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate.
| Compound Name | methyl 3-[3-[methyl-(4-phenylphenyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 58493862 |
| Molecular Formula | C36H43NO3 |
| Molecular Weight | 537.74 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | methyl 3-[3-[methyl-(4-phenylphenyl)carbamoyl]-1-adamantyl]adamantane-1-carboxylate |
| SMILES | COC(=O)C12CC3CC(C1)CC(C14CC5CC(CC(C(=O)N(C)c6ccc(-c7ccccc7)cc6)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C36H43NO3/c1-37(30-10-8-29(9-11-30)28-6-4-3-5-7-28)31(38)33-14-24-12-25(15-33)19-35(18-24,22-33)36-20-26-13-27(21-36)17-34(16-26,23-36)32(39)40-2/h3-11,24-27H,12-23H2,1-2H3 |
| InChIKey | SIIIOPPSTHMLFV-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.74 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |