C19H23ClO2 — CID 101053617
methyl (5S,7R)-3-[chloro(phenyl)methyl]adamantane-1-carboxylate (PubChem CID 101053617) has the molecular formula C19H23ClO2 and a molecular weight of 318.84 g/mol. Its IUPAC name is methyl (5S,7R)-3-[chloro(phenyl)methyl]adamantane-1-carboxylate.
| Compound Name | methyl (5S,7R)-3-[chloro(phenyl)methyl]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 101053617 |
| Molecular Formula | C19H23ClO2 |
| Molecular Weight | 318.84 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | methyl (5S,7R)-3-[chloro(phenyl)methyl]adamantane-1-carboxylate |
| SMILES | COC(=O)C12C[C@H]3C[C@@H](C1)CC(C(Cl)c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C19H23ClO2/c1-22-17(21)19-10-13-7-14(11-19)9-18(8-13,12-19)16(20)15-5-3-2-4-6-15/h2-6,13-14,16H,7-12H2,1H3/t13-,14+,16?,18?,19? |
| InChIKey | KBFFUSQYOPFJHA-ZVOHDQKOSA-N |
| XLogP | 4.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.84 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|