C21H26O4 — CID 27919005
[(2S)-1-methoxy-1-oxopropan-2-yl] (5S,7R)-3-phenyladamantane-1-carboxylate (PubChem CID 27919005) has the molecular formula C21H26O4 and a molecular weight of 342.44 g/mol. Its IUPAC name is [(2S)-1-methoxy-1-oxopropan-2-yl] (5S,7R)-3-phenyladamantane-1-carboxylate.
| Compound Name | [(2S)-1-methoxy-1-oxopropan-2-yl] (5S,7R)-3-phenyladamantane-1-carboxylate |
|---|---|
| PubChem CID | 27919005 |
| Molecular Formula | C21H26O4 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | [(2S)-1-methoxy-1-oxopropan-2-yl] (5S,7R)-3-phenyladamantane-1-carboxylate |
| SMILES | COC(=O)[C@H](C)OC(=O)C12C[C@H]3C[C@@H](C1)CC(c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C21H26O4/c1-14(18(22)24-2)25-19(23)21-11-15-8-16(12-21)10-20(9-15,13-21)17-6-4-3-5-7-17/h3-7,14-16H,8-13H2,1-2H3/t14-,15-,16+,20?,21?/m0/s1 |
| InChIKey | CPTWOFIEFVBFRM-VQQJLRODSA-N |
| XLogP | 3.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |