C27H29NO4 — CID 4028003
(2-oxo-1,2-diphenylethyl) 3-acetamidoadamantane-1-carboxylate (PubChem CID 4028003) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is (2-oxo-1,2-diphenylethyl) 3-acetamidoadamantane-1-carboxylate.
| Compound Name | (2-oxo-1,2-diphenylethyl) 3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 4028003 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | (2-oxo-1,2-diphenylethyl) 3-acetamidoadamantane-1-carboxylate |
| SMILES | CC(=O)NC12CC3CC(C1)CC(C(=O)OC(C(=O)c1ccccc1)c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C27H29NO4/c1-18(29)28-27-15-19-12-20(16-27)14-26(13-19,17-27)25(31)32-24(22-10-6-3-7-11-22)23(30)21-8-4-2-5-9-21/h2-11,19-20,24H,12-17H2,1H3,(H,28,29) |
| InChIKey | TYWHUKRREHBCEQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |