C24H31N3O5 — CID 55328379
[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-acetamidoadamantane-1-carboxylate (PubChem CID 55328379) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-acetamidoadamantane-1-carboxylate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-acetamidoadamantane-1-carboxylate |
|---|---|
| PubChem CID | 55328379 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 3-acetamidoadamantane-1-carboxylate |
| SMILES | CCNC(=O)NC(=O)C(OC(=O)C12CC3CC(CC(NC(C)=O)(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C24H31N3O5/c1-3-25-22(31)26-20(29)19(18-7-5-4-6-8-18)32-21(30)23-10-16-9-17(11-23)13-24(12-16,14-23)27-15(2)28/h4-8,16-17,19H,3,9-14H2,1-2H3,(H,27,28)(H2,25,26,29,31) |
| InChIKey | AEFDKDSQFGIDDH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |