C25H33N3O5 — CID 55309702
[2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 55309702) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 55309702 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | [2-(ethylcarbamoylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | CCNC(=O)NC(=O)C(OC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C25H33N3O5/c1-2-26-24(32)28-23(31)22(19-6-4-3-5-7-19)33-21(30)15-27-20(29)14-25-11-16-8-17(12-25)10-18(9-16)13-25/h3-7,16-18,22H,2,8-15H2,1H3,(H,27,29)(H2,26,28,31,32) |
| InChIKey | DXPMIKYXRAKXDQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |