C24H32N2O4 — CID 7715777
[(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate (PubChem CID 7715777) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate.
| Compound Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 7715777 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [(1R)-2-(dimethylamino)-2-oxo-1-phenylethyl] 2-[[2-(1-adamantyl)acetyl]amino]acetate |
| SMILES | CN(C)C(=O)[C@H](OC(=O)CNC(=O)CC12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O4/c1-26(2)23(29)22(19-6-4-3-5-7-19)30-21(28)15-25-20(27)14-24-11-16-8-17(12-24)10-18(9-16)13-24/h3-7,16-18,22H,8-15H2,1-2H3,(H,25,27)/t16?,17?,18?,22-,24?/m1/s1 |
| InChIKey | BNROXFJPHIUNTB-YFZSMNHSSA-N |
| XLogP | 3.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |