C19H25NO — CID 3560004
2-(1-adamantyl)-N-benzylacetamide (PubChem CID 3560004) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-benzylacetamide.
| Compound Name | 2-(1-adamantyl)-N-benzylacetamide |
|---|---|
| PubChem CID | 3560004 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-(1-adamantyl)-N-benzylacetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCc1ccccc1 |
| InChI | InChI=1S/C19H25NO/c21-18(20-13-14-4-2-1-3-5-14)12-19-9-15-6-16(10-19)8-17(7-15)11-19/h1-5,15-17H,6-13H2,(H,20,21) |
| InChIKey | YQBDBDHKAYEANT-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |