C19H24ClNO — CID 8934558
2-(1-adamantyl)-N-[(2-chlorophenyl)methyl]acetamide (PubChem CID 8934558) has the molecular formula C19H24ClNO and a molecular weight of 317.86 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[(2-chlorophenyl)methyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[(2-chlorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 8934558 |
| Molecular Formula | C19H24ClNO |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-(1-adamantyl)-N-[(2-chlorophenyl)methyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCc1ccccc1Cl |
| InChI | InChI=1S/C19H24ClNO/c20-17-4-2-1-3-16(17)12-21-18(22)11-19-8-13-5-14(9-19)7-15(6-13)10-19/h1-4,13-15H,5-12H2,(H,21,22) |
| InChIKey | SEWJIKBRALADEA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |