C24H32ClN3O4S — CID 27800102
2-(1-adamantyl)-N-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]acetamide (PubChem CID 27800102) has the molecular formula C24H32ClN3O4S and a molecular weight of 494.06 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 27800102 |
| Molecular Formula | C24H32ClN3O4S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 2-(1-adamantyl)-N-[2-[4-(2-chlorophenyl)sulfonylpiperazin-1-yl]-2-oxoethyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCC(=O)N1CCN(S(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C24H32ClN3O4S/c25-20-3-1-2-4-21(20)33(31,32)28-7-5-27(6-8-28)23(30)16-26-22(29)15-24-12-17-9-18(13-24)11-19(10-17)14-24/h1-4,17-19H,5-16H2,(H,26,29) |
| InChIKey | JIRLTGJUJNISSK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |