C22H27ClN2O4 — CID 7190874
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 7190874) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 7190874 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)NCc1ccccc1Cl |
| InChI | InChI=1S/C22H27ClN2O4/c23-18-4-2-1-3-17(18)11-24-19(26)13-29-20(27)12-25-21(28)22-8-14-5-15(9-22)7-16(6-14)10-22/h1-4,14-16H,5-13H2,(H,24,26)(H,25,28) |
| InChIKey | SWNNZYGEQLMERZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |