C21H24ClFN2O4 — CID 3971040
[2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 3971040) has the molecular formula C21H24ClFN2O4 and a molecular weight of 422.88 g/mol. Its IUPAC name is [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 3971040 |
| Molecular Formula | C21H24ClFN2O4 |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | [2-(2-chloro-4-fluoroanilino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H24ClFN2O4/c22-16-6-15(23)1-2-17(16)25-18(26)11-29-19(27)10-24-20(28)21-7-12-3-13(8-21)5-14(4-12)9-21/h1-2,6,12-14H,3-5,7-11H2,(H,24,28)(H,25,26) |
| InChIKey | BZYCHPFMLIMTKZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |