C24H31N3O5 — CID 34328308
[2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 34328308) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 34328308 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | [2-[3-(ethylcarbamoyl)anilino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | CCNC(=O)c1cccc(NC(=O)COC(=O)CNC(=O)C23CC4CC(CC(C4)C2)C3)c1 |
| InChI | InChI=1S/C24H31N3O5/c1-2-25-22(30)18-4-3-5-19(9-18)27-20(28)14-32-21(29)13-26-23(31)24-10-15-6-16(11-24)8-17(7-15)12-24/h3-5,9,15-17H,2,6-8,10-14H2,1H3,(H,25,30)(H,26,31)(H,27,28) |
| InChIKey | SIPZXIYNOHQRON-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |