C16H24N2O4 — CID 3667781
[2-(methylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 3667781) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 3667781 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | CNC(=O)COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C16H24N2O4/c1-17-13(19)9-22-14(20)8-18-15(21)16-5-10-2-11(6-16)4-12(3-10)7-16/h10-12H,2-9H2,1H3,(H,17,19)(H,18,21) |
| InChIKey | WCULXKRKBSKAQR-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |