C21H27NO3 — CID 7190613
(4-methylphenyl)methyl 2-(adamantane-1-carbonylamino)acetate (PubChem CID 7190613) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (4-methylphenyl)methyl 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | (4-methylphenyl)methyl 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 7190613 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (4-methylphenyl)methyl 2-(adamantane-1-carbonylamino)acetate |
| SMILES | Cc1ccc(COC(=O)CNC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C21H27NO3/c1-14-2-4-15(5-3-14)13-25-19(23)12-22-20(24)21-9-16-6-17(10-21)8-18(7-16)11-21/h2-5,16-18H,6-13H2,1H3,(H,22,24) |
| InChIKey | DZDGPACOABLBAK-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |