C24H32N2O4 — CID 7190949
[2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 7190949) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is [2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 7190949 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | [2-[benzyl(ethyl)amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | CCN(Cc1ccccc1)C(=O)COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H32N2O4/c1-2-26(15-17-6-4-3-5-7-17)21(27)16-30-22(28)14-25-23(29)24-11-18-8-19(12-24)10-20(9-18)13-24/h3-7,18-20H,2,8-16H2,1H3,(H,25,29) |
| InChIKey | DTFKPUZOSREJGG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |