C23H29N3O5 — CID 7190632
[2-(benzylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 7190632) has the molecular formula C23H29N3O5 and a molecular weight of 427.50 g/mol. Its IUPAC name is [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 7190632 |
| Molecular Formula | C23H29N3O5 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [2-(benzylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)NC(=O)NCc1ccccc1 |
| InChI | InChI=1S/C23H29N3O5/c27-19(26-22(30)25-12-15-4-2-1-3-5-15)14-31-20(28)13-24-21(29)23-9-16-6-17(10-23)8-18(7-16)11-23/h1-5,16-18H,6-14H2,(H,24,29)(H2,25,26,27,30) |
| InChIKey | IUOAUWQXPCOGCH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |