C23H26F2N2O6 — CID 3689491
[2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 3689491) has the molecular formula C23H26F2N2O6 and a molecular weight of 464.47 g/mol. Its IUPAC name is [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 3689491 |
| Molecular Formula | C23H26F2N2O6 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | [2-[[4-(difluoromethoxy)benzoyl]amino]-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | O=C(COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C23H26F2N2O6/c24-22(25)33-17-3-1-16(2-4-17)20(30)27-18(28)12-32-19(29)11-26-21(31)23-8-13-5-14(9-23)7-15(6-13)10-23/h1-4,13-15,22H,5-12H2,(H,26,31)(H,27,28,30) |
| InChIKey | KUOIIGRVOLLFLF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |