C17H25N3O5 — CID 3258718
[2-(methylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate (PubChem CID 3258718) has the molecular formula C17H25N3O5 and a molecular weight of 351.40 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
|---|---|
| PubChem CID | 3258718 |
| Molecular Formula | C17H25N3O5 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 2-(adamantane-1-carbonylamino)acetate |
| SMILES | CNC(=O)NC(=O)COC(=O)CNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H25N3O5/c1-18-16(24)20-13(21)9-25-14(22)8-19-15(23)17-5-10-2-11(6-17)4-12(3-10)7-17/h10-12H,2-9H2,1H3,(H,19,23)(H2,18,20,21,24) |
| InChIKey | XFIVOSLQPUDLNF-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |