C20H23F2NO3S — CID 8513262
N-[2-(1-adamantylsulfanyl)acetyl]-4-(difluoromethoxy)benzamide (PubChem CID 8513262) has the molecular formula C20H23F2NO3S and a molecular weight of 395.47 g/mol. Its IUPAC name is N-[2-(1-adamantylsulfanyl)acetyl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[2-(1-adamantylsulfanyl)acetyl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 8513262 |
| Molecular Formula | C20H23F2NO3S |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[2-(1-adamantylsulfanyl)acetyl]-4-(difluoromethoxy)benzamide |
| SMILES | O=C(CSC12CC3CC(CC(C3)C1)C2)NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H23F2NO3S/c21-19(22)26-16-3-1-15(2-4-16)18(25)23-17(24)11-27-20-8-12-5-13(9-20)7-14(6-12)10-20/h1-4,12-14,19H,5-11H2,(H,23,24,25) |
| InChIKey | BESHTVNJWSXQCZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |